// Copyright 2011 Mark Cavage, Inc. All rights reserved. const assert = require('assert-plus') const util = require('util') const asn1 = require('@ldapjs/asn1') const logger = require('../logger') // var Control = require('../controls').Control /// --- Globals // var Ber = asn1.Ber // var BerReader = asn1.BerReader const BerWriter = asn1.BerWriter const getControl = require('../controls').getControl /// --- API /** * LDAPMessage structure. * * @param {Object} options stuff. */ function LDAPMessage (options) { assert.object(options) this.messageID = options.messageID || 0 this.protocolOp = options.protocolOp || undefined this.controls = options.controls ? options.controls.slice(0) : [] this.log = options.log || logger } Object.defineProperties(LDAPMessage.prototype, { id: { get: function getId () { return this.messageID }, configurable: false }, dn: { get: function getDN () { return this._dn || '' }, configurable: false }, type: { get: function getType () { return 'LDAPMessage' }, configurable: false }, json: { get: function () { const out = this._json({ messageID: this.messageID, protocolOp: this.type }) out.controls = this.controls return out }, configurable: false } }) LDAPMessage.prototype.toString = function () { return JSON.stringify(this.json) } LDAPMessage.prototype.parse = function (ber) { assert.ok(ber) this.log.trace('parse: data=%s', util.inspect(ber.buffer)) // Delegate off to the specific type to parse this._parse(ber, ber.length) // Look for controls if (ber.peek() === 0xa0) { ber.readSequence() const end = ber.offset + ber.length while (ber.offset < end) { const c = getControl(ber) if (c) { this.controls.push(c) } } } this.log.trace('Parsing done: %j', this.json) return true } LDAPMessage.prototype.toBer = function () { let writer = new BerWriter() writer.startSequence() writer.writeInt(this.messageID) writer.startSequence(this.protocolOp) if (this._toBer) { writer = this._toBer(writer) } writer.endSequence() if (this.controls && this.controls.length) { writer.startSequence(0xa0) this.controls.forEach(function (c) { c.toBer(writer) }) writer.endSequence() } writer.endSequence() return writer.buffer } /// --- Exports module.exports = LDAPMessage